About disulfanylmethylurea
disulfanylmethylurea (PubChem CID 54338573) has the molecular formula C2H6N2OS2
and a molecular weight of 138.22 g/mol. Its IUPAC name is disulfanylmethylurea.
Molecular Properties
| Compound Name | disulfanylmethylurea |
| PubChem CID | 54338573 |
| Molecular Formula | C2H6N2OS2 |
| Molecular Weight | 138.22 g/mol |
| Exact Mass | 137.99 |
| IUPAC Name | disulfanylmethylurea |
| SMILES | NC(=O)NCSS |
| InChI | InChI=1S/C2H6N2OS2/c3-2(5)4-1-7-6/h6H,1H2,(H3,3,4,5) |
| InChIKey | TXHJBCQUTVPSGM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze disulfanylmethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disulfanylmethylurea?
The IUPAC name of disulfanylmethylurea (CID 54338573) is disulfanylmethylurea.
What is the SMILES notation for disulfanylmethylurea?
The canonical SMILES for disulfanylmethylurea is NC(=O)NCSS.
What is the InChIKey of disulfanylmethylurea?
The InChIKey is TXHJBCQUTVPSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2OS2/c3-2(5)4-1-7-6/h6H,1H2,(H3,3,4,5).
What are the key properties of disulfanylmethylurea?
disulfanylmethylurea has a molecular weight of 138.22 g/mol, XLogP of 0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disulfanylmethylurea is sourced from PubChem (CID 54338573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).