About 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol
2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol (PubChem CID 54339278) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol.
Molecular Properties
| Compound Name | 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol |
| PubChem CID | 54339278 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol |
| SMILES | CC1Oc2ccccc2-c2c1c(O)n(CCO)c2O |
| InChI | InChI=1S/C14H15NO4/c1-8-11-12(9-4-2-3-5-10(9)19-8)14(18)15(6-7-16)13(11)17/h2-5,8,16-18H,6-7H2,1H3 |
| InChIKey | TXTQQNVJFYIONY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol?
The IUPAC name of 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol (CID 54339278) is 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol.
What is the SMILES notation for 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol?
The canonical SMILES for 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol is CC1Oc2ccccc2-c2c1c(O)n(CCO)c2O.
What is the InChIKey of 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol?
The InChIKey is TXTQQNVJFYIONY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-8-11-12(9-4-2-3-5-10(9)19-8)14(18)15(6-7-16)13(11)17/h2-5,8,16-18H,6-7H2,1H3.
What are the key properties of 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol?
2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol has a molecular weight of 261.28 g/mol, XLogP of 2.01, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethyl)-4-methyl-4H-chromeno[3,4-c]pyrrole-1,3-diol is sourced from PubChem (CID 54339278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).