About 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate
5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate (PubChem CID 54340414) has the molecular formula C21H36O8
and a molecular weight of 416.51 g/mol. Its IUPAC name is 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate.
Molecular Properties
| Compound Name | 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate |
| PubChem CID | 54340414 |
| Molecular Formula | C21H36O8 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate |
| SMILES | C=CCOOCCOC(=O)CCCC(=O)OCCOC(=O)C(C)CC(C)(C)CC |
| InChI | InChI=1S/C21H36O8/c1-6-11-28-29-15-14-26-19(23)10-8-9-18(22)25-12-13-27-20(24)17(3)16-21(4,5)7-2/h6,17H,1,7-16H2,2-5H3 |
| InChIKey | TYNPITHBSAXAGO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate?
The IUPAC name of 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate (CID 54340414) is 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate.
What is the SMILES notation for 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate?
The canonical SMILES for 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate is C=CCOOCCOC(=O)CCCC(=O)OCCOC(=O)C(C)CC(C)(C)CC.
What is the InChIKey of 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate?
The InChIKey is TYNPITHBSAXAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36O8/c1-6-11-28-29-15-14-26-19(23)10-8-9-18(22)25-12-13-27-20(24)17(3)16-21(4,5)7-2/h6,17H,1,7-16H2,2-5H3.
What are the key properties of 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate?
5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate has a molecular weight of 416.51 g/mol, XLogP of 3.38, 17 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-(2-prop-2-enylperoxyethyl) 1-O-[2-(2,4,4-trimethylhexanoyloxy)ethyl] pentanedioate is sourced from PubChem (CID 54340414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).