C12H13NO4 — CID 54340461
2-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)acetic acid (PubChem CID 54340461) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)acetic acid.
| Compound Name | 2-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)acetic acid |
|---|---|
| PubChem CID | 54340461 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)acetic acid |
| SMILES | O=C(O)Cn1c(O)c2c(c1O)C1C=CC2CC1 |
| InChI | InChI=1S/C12H13NO4/c14-8(15)5-13-11(16)9-6-1-2-7(4-3-6)10(9)12(13)17/h1-2,6-7,16-17H,3-5H2,(H,14,15) |
| InChIKey | TYOOZZWCSJGPAT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|