C12H2F6O6 — CID 54340577
3a,7a-bis(trifluoromethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 54340577) has the molecular formula C12H2F6O6 and a molecular weight of 356.13 g/mol. Its IUPAC name is 3a,7a-bis(trifluoromethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 3a,7a-bis(trifluoromethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 54340577 |
| Molecular Formula | C12H2F6O6 |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 3a,7a-bis(trifluoromethyl)furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=C1OC(=O)C2(C(F)(F)F)C=C3C(=O)OC(=O)C3(C(F)(F)F)C=C12 |
| InChI | InChI=1S/C12H2F6O6/c13-11(14,15)9-1-3-5(19)23-8(22)10(3,12(16,17)18)2-4(9)6(20)24-7(9)21/h1-2H |
| InChIKey | TYQWGJDWSCEQIP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|