C27H34N4O — CID 54341112
(6aR)-9-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 54341112) has the molecular formula C27H34N4O and a molecular weight of 430.60 g/mol. Its IUPAC name is (6aR)-9-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR)-9-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 54341112 |
| Molecular Formula | C27H34N4O |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (6aR)-9-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | COc1ccc(N2CCN(CC3CC4c5cccc6[nH]cc(c56)C[C@H]4N(C)C3)CC2)cc1 |
| InChI | InChI=1S/C27H34N4O/c1-29-17-19(14-24-23-4-3-5-25-27(23)20(16-28-25)15-26(24)29)18-30-10-12-31(13-11-30)21-6-8-22(32-2)9-7-21/h3-9,16,19,24,26,28H,10-15,17-18H2,1-2H3/t19?,24?,26-/m1/s1 |
| InChIKey | TZAGFHFRNZSDBY-CFSSFWDRSA-N |
| XLogP | 3.96 |
| TPSA | 34.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|