N-ethenyl-N-ethylsulfamoyl chloride

C4H8ClNO2S — CID 54341286

IUPACN-ethenyl-N-ethylsulfamoyl chloride
SMILESC=CN(CC)S(=O)(=O)Cl
InChIInChI=1S/C4H8ClNO2S/c1-3-6(4-2)9(5,7)8/h3H,1,4H2,2H3
InChIKeyTZCXJGUXNIZWOR-UHFFFAOYSA-N
MW169.63 g/mol
LogP0.94
Rot. Bonds3

About N-ethenyl-N-ethylsulfamoyl chloride

N-ethenyl-N-ethylsulfamoyl chloride (PubChem CID 54341286) has the molecular formula C4H8ClNO2S and a molecular weight of 169.63 g/mol. Its IUPAC name is N-ethenyl-N-ethylsulfamoyl chloride.

Molecular Properties

Compound NameN-ethenyl-N-ethylsulfamoyl chloride
PubChem CID54341286
Molecular FormulaC4H8ClNO2S
Molecular Weight169.63 g/mol
Exact Mass169.00
IUPAC NameN-ethenyl-N-ethylsulfamoyl chloride
SMILESC=CN(CC)S(=O)(=O)Cl
InChIInChI=1S/C4H8ClNO2S/c1-3-6(4-2)9(5,7)8/h3H,1,4H2,2H3
InChIKeyTZCXJGUXNIZWOR-UHFFFAOYSA-N
XLogP0.94
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.63
LogP ≤ 50.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N-ethenyl-N-ethylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-ethenyl-N-ethylsulfamoyl chloride?
The IUPAC name of N-ethenyl-N-ethylsulfamoyl chloride (CID 54341286) is N-ethenyl-N-ethylsulfamoyl chloride.
What is the SMILES notation for N-ethenyl-N-ethylsulfamoyl chloride?
The canonical SMILES for N-ethenyl-N-ethylsulfamoyl chloride is C=CN(CC)S(=O)(=O)Cl.
What is the InChIKey of N-ethenyl-N-ethylsulfamoyl chloride?
The InChIKey is TZCXJGUXNIZWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO2S/c1-3-6(4-2)9(5,7)8/h3H,1,4H2,2H3.
What are the key properties of N-ethenyl-N-ethylsulfamoyl chloride?
N-ethenyl-N-ethylsulfamoyl chloride has a molecular weight of 169.63 g/mol, XLogP of 0.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-ethylsulfamoyl chloride is sourced from PubChem (CID 54341286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).