C17H23N5S — CID 54341347
5-[5-(4-phenyl-1,2,5,6-tetrahydropyrimidin-2-yl)pentyl]-1,3,4-thiadiazol-2-amine (PubChem CID 54341347) has the molecular formula C17H23N5S and a molecular weight of 329.47 g/mol. Its IUPAC name is 5-[5-(4-phenyl-1,2,5,6-tetrahydropyrimidin-2-yl)pentyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[5-(4-phenyl-1,2,5,6-tetrahydropyrimidin-2-yl)pentyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 54341347 |
| Molecular Formula | C17H23N5S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 5-[5-(4-phenyl-1,2,5,6-tetrahydropyrimidin-2-yl)pentyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(CCCCCC2N=C(c3ccccc3)CCN2)s1 |
| InChI | InChI=1S/C17H23N5S/c18-17-22-21-16(23-17)10-6-2-5-9-15-19-12-11-14(20-15)13-7-3-1-4-8-13/h1,3-4,7-8,15,19H,2,5-6,9-12H2,(H2,18,22) |
| InChIKey | TZDZWGMFQIKKCA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|