C27H41NO7S — CID 54341508
1,2-dihydroxy-3-[3-[2-(methoxymethyl)-1,3-thiazol-4-yl]prop-1-enyl]-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 54341508) has the molecular formula C27H41NO7S and a molecular weight of 523.69 g/mol. Its IUPAC name is 1,2-dihydroxy-3-[3-[2-(methoxymethyl)-1,3-thiazol-4-yl]prop-1-enyl]-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 1,2-dihydroxy-3-[3-[2-(methoxymethyl)-1,3-thiazol-4-yl]prop-1-enyl]-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 54341508 |
| Molecular Formula | C27H41NO7S |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 1,2-dihydroxy-3-[3-[2-(methoxymethyl)-1,3-thiazol-4-yl]prop-1-enyl]-8,8,10,12-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | COCc1nc(CC=CC2OC(=O)CCC(C)(C)C(=O)C(C)CC(C)CCCC3OC3(O)C2O)cs1 |
| InChI | InChI=1S/C27H41NO7S/c1-17-8-6-11-21-27(32,35-21)25(31)20(10-7-9-19-16-36-22(28-19)15-33-5)34-23(29)12-13-26(3,4)24(30)18(2)14-17/h7,10,16-18,20-21,25,31-32H,6,8-9,11-15H2,1-5H3 |
| InChIKey | TZGSVDODLINQSD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|