C9H17N5O — CID 54341536
6-tert-butyl-3,4-bis(methylamino)-1,2,4-triazin-5-one (PubChem CID 54341536) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 6-tert-butyl-3,4-bis(methylamino)-1,2,4-triazin-5-one.
| Compound Name | 6-tert-butyl-3,4-bis(methylamino)-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 54341536 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 6-tert-butyl-3,4-bis(methylamino)-1,2,4-triazin-5-one |
| SMILES | CNc1nnc(C(C)(C)C)c(=O)n1NC |
| InChI | InChI=1S/C9H17N5O/c1-9(2,3)6-7(15)14(11-5)8(10-4)13-12-6/h11H,1-5H3,(H,10,13) |
| InChIKey | TZHJIUXYXFVNDP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |