About 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol
7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol (PubChem CID 54342152) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol.
Molecular Properties
| Compound Name | 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol |
| PubChem CID | 54342152 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol |
| SMILES | Cc1cc2cc(C)c(C)c(O)c2cc1N(C)C |
| InChI | InChI=1S/C15H19NO/c1-9-6-12-7-10(2)14(16(4)5)8-13(12)15(17)11(9)3/h6-8,17H,1-5H3 |
| InChIKey | TZSPBTWUQYPUSG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol?
The IUPAC name of 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol (CID 54342152) is 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol.
What is the SMILES notation for 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol?
The canonical SMILES for 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol is Cc1cc2cc(C)c(C)c(O)c2cc1N(C)C.
What is the InChIKey of 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol?
The InChIKey is TZSPBTWUQYPUSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO/c1-9-6-12-7-10(2)14(16(4)5)8-13(12)15(17)11(9)3/h6-8,17H,1-5H3.
What are the key properties of 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol?
7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol has a molecular weight of 229.32 g/mol, XLogP of 3.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(dimethylamino)-2,3,6-trimethylnaphthalen-1-ol is sourced from PubChem (CID 54342152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).