About ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate
ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate (PubChem CID 54342719) has the molecular formula C19H20N2O3S
and a molecular weight of 356.45 g/mol. Its IUPAC name is ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate |
| PubChem CID | 54342719 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(Nc2nc3ccccc3s2)c(O)c1C |
| InChI | InChI=1S/C19H20N2O3S/c1-3-24-17(22)11-9-13-8-10-15(18(23)12(13)2)21-19-20-14-6-4-5-7-16(14)25-19/h4-8,10,23H,3,9,11H2,1-2H3,(H,20,21) |
| InChIKey | UADAESRMNIMROK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate?
The IUPAC name of ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate (CID 54342719) is ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate.
What is the SMILES notation for ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate?
The canonical SMILES for ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate is CCOC(=O)CCc1ccc(Nc2nc3ccccc3s2)c(O)c1C.
What is the InChIKey of ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate?
The InChIKey is UADAESRMNIMROK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3S/c1-3-24-17(22)11-9-13-8-10-15(18(23)12(13)2)21-19-20-14-6-4-5-7-16(14)25-19/h4-8,10,23H,3,9,11H2,1-2H3,(H,20,21).
What are the key properties of ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate?
ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate has a molecular weight of 356.45 g/mol, XLogP of 4.55, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-(1,3-benzothiazol-2-ylamino)-3-hydroxy-2-methylphenyl]propanoate is sourced from PubChem (CID 54342719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).