About ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate
ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate (PubChem CID 54343498) has the molecular formula C15H13Cl2F2NO3
and a molecular weight of 364.18 g/mol. Its IUPAC name is ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate |
| PubChem CID | 54343498 |
| Molecular Formula | C15H13Cl2F2NO3 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(/C=N/C1CC1)C(=O)c1c(F)cc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C15H13Cl2F2NO3/c1-2-23-15(22)8(6-20-7-3-4-7)14(21)11-10(18)5-9(16)13(19)12(11)17/h5-8H,2-4H2,1H3/b20-6+ |
| InChIKey | UAPRPSCYJVGLBO-CGOBSMCZSA-N |
| XLogP | 3.87 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate?
The IUPAC name of ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate (CID 54343498) is ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate.
What is the SMILES notation for ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate?
The canonical SMILES for ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate is CCOC(=O)C(/C=N/C1CC1)C(=O)c1c(F)cc(Cl)c(F)c1Cl.
What is the InChIKey of ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate?
The InChIKey is UAPRPSCYJVGLBO-CGOBSMCZSA-N. The full InChI is InChI=1S/C15H13Cl2F2NO3/c1-2-23-15(22)8(6-20-7-3-4-7)14(21)11-10(18)5-9(16)13(19)12(11)17/h5-8H,2-4H2,1H3/b20-6+.
What are the key properties of ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate?
ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate has a molecular weight of 364.18 g/mol, XLogP of 3.87, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(cyclopropyliminomethyl)-3-(2,4-dichloro-3,6-difluorophenyl)-3-oxopropanoate is sourced from PubChem (CID 54343498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).