C13H8F4N2O — CID 54343569
2-(cyclopropyliminomethyl)-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanenitrile (PubChem CID 54343569) has the molecular formula C13H8F4N2O and a molecular weight of 284.21 g/mol. Its IUPAC name is 2-(cyclopropyliminomethyl)-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanenitrile.
| Compound Name | 2-(cyclopropyliminomethyl)-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 54343569 |
| Molecular Formula | C13H8F4N2O |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-(cyclopropyliminomethyl)-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanenitrile |
| SMILES | N#CC(/C=N/C1CC1)C(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H8F4N2O/c14-9-3-8(10(15)12(17)11(9)16)13(20)6(4-18)5-19-7-1-2-7/h3,5-7H,1-2H2/b19-5+ |
| InChIKey | UARIFFMSZOWHHI-PTXOJBNSSA-N |
| XLogP | 2.80 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|