About (butan-2-ylideneamino) carbamate
(butan-2-ylideneamino) carbamate (PubChem CID 54343836) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is (butan-2-ylideneamino) carbamate.
Molecular Properties
| Compound Name | (butan-2-ylideneamino) carbamate |
| PubChem CID | 54343836 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | (butan-2-ylideneamino) carbamate |
| SMILES | CCC(C)=NOC(N)=O |
| InChI | InChI=1S/C5H10N2O2/c1-3-4(2)7-9-5(6)8/h3H2,1-2H3,(H2,6,8) |
| InChIKey | UAWQMCPBZDCASH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (butan-2-ylideneamino) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (butan-2-ylideneamino) carbamate?
The IUPAC name of (butan-2-ylideneamino) carbamate (CID 54343836) is (butan-2-ylideneamino) carbamate.
What is the SMILES notation for (butan-2-ylideneamino) carbamate?
The canonical SMILES for (butan-2-ylideneamino) carbamate is CCC(C)=NOC(N)=O.
What is the InChIKey of (butan-2-ylideneamino) carbamate?
The InChIKey is UAWQMCPBZDCASH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-3-4(2)7-9-5(6)8/h3H2,1-2H3,(H2,6,8).
What are the key properties of (butan-2-ylideneamino) carbamate?
(butan-2-ylideneamino) carbamate has a molecular weight of 130.15 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (butan-2-ylideneamino) carbamate is sourced from PubChem (CID 54343836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).