C26H35N3O4 — CID 54343878
tert-butyl (2R)-2-[[4-[3-[2-(imidazol-1-ylmethyl)phenyl]prop-2-enoxy]-4-oxobut-2-enyl]amino]-3-methylbutanoate (PubChem CID 54343878) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[4-[3-[2-(imidazol-1-ylmethyl)phenyl]prop-2-enoxy]-4-oxobut-2-enyl]amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-[[4-[3-[2-(imidazol-1-ylmethyl)phenyl]prop-2-enoxy]-4-oxobut-2-enyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 54343878 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | tert-butyl (2R)-2-[[4-[3-[2-(imidazol-1-ylmethyl)phenyl]prop-2-enoxy]-4-oxobut-2-enyl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NCC=CC(=O)OCC=Cc1ccccc1Cn1ccnc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35N3O4/c1-20(2)24(25(31)33-26(3,4)5)28-14-8-13-23(30)32-17-9-12-21-10-6-7-11-22(21)18-29-16-15-27-19-29/h6-13,15-16,19-20,24,28H,14,17-18H2,1-5H3/t24-/m1/s1 |
| InChIKey | UAXHPMVMUXSXCF-XMMPIXPASA-N |
| XLogP | 4.00 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|