About 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one
6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 54344134) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one.
Molecular Properties
| Compound Name | 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one |
| PubChem CID | 54344134 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | CC(=O)C(C)n1ccc2c(c1=O)NCC2 |
| InChI | InChI=1S/C11H14N2O2/c1-7(8(2)14)13-6-4-9-3-5-12-10(9)11(13)15/h4,6-7,12H,3,5H2,1-2H3 |
| InChIKey | UBBRAMFAKXSTPX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one?
The IUPAC name of 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one (CID 54344134) is 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one.
What is the SMILES notation for 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one?
The canonical SMILES for 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one is CC(=O)C(C)n1ccc2c(c1=O)NCC2.
What is the InChIKey of 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one?
The InChIKey is UBBRAMFAKXSTPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-7(8(2)14)13-6-4-9-3-5-12-10(9)11(13)15/h4,6-7,12H,3,5H2,1-2H3.
What are the key properties of 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one?
6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one has a molecular weight of 206.25 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-oxobutan-2-yl)-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-7-one is sourced from PubChem (CID 54344134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).