About (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate
(3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate (PubChem CID 54344614) has the molecular formula C25H24F2O3S
and a molecular weight of 442.53 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate.
Molecular Properties
| Compound Name | (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate |
| PubChem CID | 54344614 |
| Molecular Formula | C25H24F2O3S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate |
| SMILES | CC(C)C(F)(F)Sc1ccc(CC(=O)OCc2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H24F2O3S/c1-18(2)25(26,27)31-23-13-11-19(12-14-23)16-24(28)29-17-20-7-6-10-22(15-20)30-21-8-4-3-5-9-21/h3-15,18H,16-17H2,1-2H3 |
| InChIKey | UBKLIQNJCAXNLU-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate?
The IUPAC name of (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate (CID 54344614) is (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate.
What is the SMILES notation for (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate?
The canonical SMILES for (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate is CC(C)C(F)(F)Sc1ccc(CC(=O)OCc2cccc(Oc3ccccc3)c2)cc1.
What is the InChIKey of (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate?
The InChIKey is UBKLIQNJCAXNLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24F2O3S/c1-18(2)25(26,27)31-23-13-11-19(12-14-23)16-24(28)29-17-20-7-6-10-22(15-20)30-21-8-4-3-5-9-21/h3-15,18H,16-17H2,1-2H3.
What are the key properties of (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate?
(3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate has a molecular weight of 442.53 g/mol, XLogP of 7.11, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenoxyphenyl)methyl 2-[4-(1,1-difluoro-2-methylpropyl)sulfanylphenyl]acetate is sourced from PubChem (CID 54344614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).