About 5-methylidene-1,2,4-triazol-3-one
5-methylidene-1,2,4-triazol-3-one (PubChem CID 54344768) has the molecular formula C3H3N3O
and a molecular weight of 97.08 g/mol. Its IUPAC name is 5-methylidene-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 5-methylidene-1,2,4-triazol-3-one |
| PubChem CID | 54344768 |
| Molecular Formula | C3H3N3O |
| Molecular Weight | 97.08 g/mol |
| Exact Mass | 97.03 |
| IUPAC Name | 5-methylidene-1,2,4-triazol-3-one |
| SMILES | C=C1N=NC(=O)N1 |
| InChI | InChI=1S/C3H3N3O/c1-2-4-3(7)6-5-2/h1H2,(H,4,7) |
| InChIKey | UBNCAVCCTZYMRK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.08 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylidene-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidene-1,2,4-triazol-3-one?
The IUPAC name of 5-methylidene-1,2,4-triazol-3-one (CID 54344768) is 5-methylidene-1,2,4-triazol-3-one.
What is the SMILES notation for 5-methylidene-1,2,4-triazol-3-one?
The canonical SMILES for 5-methylidene-1,2,4-triazol-3-one is C=C1N=NC(=O)N1.
What is the InChIKey of 5-methylidene-1,2,4-triazol-3-one?
The InChIKey is UBNCAVCCTZYMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O/c1-2-4-3(7)6-5-2/h1H2,(H,4,7).
What are the key properties of 5-methylidene-1,2,4-triazol-3-one?
5-methylidene-1,2,4-triazol-3-one has a molecular weight of 97.08 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidene-1,2,4-triazol-3-one is sourced from PubChem (CID 54344768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).