About 3-butyl-4-chlorooxane
3-butyl-4-chlorooxane (PubChem CID 543450) has the molecular formula C9H17ClO
and a molecular weight of 176.69 g/mol. Its IUPAC name is 3-butyl-4-chlorooxane.
Molecular Properties
| Compound Name | 3-butyl-4-chlorooxane |
| PubChem CID | 543450 |
| Molecular Formula | C9H17ClO |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3-butyl-4-chlorooxane |
| SMILES | CCCCC1COCCC1Cl |
| InChI | InChI=1S/C9H17ClO/c1-2-3-4-8-7-11-6-5-9(8)10/h8-9H,2-7H2,1H3 |
| InChIKey | INMCIIZTCKODED-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-4-chlorooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4-chlorooxane?
The IUPAC name of 3-butyl-4-chlorooxane (CID 543450) is 3-butyl-4-chlorooxane.
What is the SMILES notation for 3-butyl-4-chlorooxane?
The canonical SMILES for 3-butyl-4-chlorooxane is CCCCC1COCCC1Cl.
What is the InChIKey of 3-butyl-4-chlorooxane?
The InChIKey is INMCIIZTCKODED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClO/c1-2-3-4-8-7-11-6-5-9(8)10/h8-9H,2-7H2,1H3.
What are the key properties of 3-butyl-4-chlorooxane?
3-butyl-4-chlorooxane has a molecular weight of 176.69 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4-chlorooxane is sourced from PubChem (CID 543450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).