About 2-chloro-N,N-dimethylethenamine
2-chloro-N,N-dimethylethenamine (PubChem CID 54345185) has the molecular formula C4H8ClN
and a molecular weight of 105.57 g/mol. Its IUPAC name is 2-chloro-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 2-chloro-N,N-dimethylethenamine |
| PubChem CID | 54345185 |
| Molecular Formula | C4H8ClN |
| Molecular Weight | 105.57 g/mol |
| Exact Mass | 105.03 |
| IUPAC Name | 2-chloro-N,N-dimethylethenamine |
| SMILES | CN(C)C=CCl |
| InChI | InChI=1S/C4H8ClN/c1-6(2)4-3-5/h3-4H,1-2H3 |
| InChIKey | YSDPJBXWIOKILQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.57 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-dimethylethenamine?
The IUPAC name of 2-chloro-N,N-dimethylethenamine (CID 54345185) is 2-chloro-N,N-dimethylethenamine.
What is the SMILES notation for 2-chloro-N,N-dimethylethenamine?
The canonical SMILES for 2-chloro-N,N-dimethylethenamine is CN(C)C=CCl.
What is the InChIKey of 2-chloro-N,N-dimethylethenamine?
The InChIKey is YSDPJBXWIOKILQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClN/c1-6(2)4-3-5/h3-4H,1-2H3.
What are the key properties of 2-chloro-N,N-dimethylethenamine?
2-chloro-N,N-dimethylethenamine has a molecular weight of 105.57 g/mol, XLogP of 1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-dimethylethenamine is sourced from PubChem (CID 54345185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).