C23H36O5 — CID 54345194
7-[(1R,2R)-2-(4-ethenyl-4-hydroxynon-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid (PubChem CID 54345194) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(4-ethenyl-4-hydroxynon-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-(4-ethenyl-4-hydroxynon-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
|---|---|
| PubChem CID | 54345194 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 7-[(1R,2R)-2-(4-ethenyl-4-hydroxynon-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
| SMILES | C=CC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O)CCCCC |
| InChI | InChI=1S/C23H36O5/c1-3-5-9-16-23(28,4-2)17-10-11-18-14-15-20(24)19(18)12-7-6-8-13-21(25)22(26)27/h4,6-7,10-11,18-19,21,25,28H,2-3,5,8-9,12-17H2,1H3,(H,26,27)/t18-,19+,21?,23?/m0/s1 |
| InChIKey | UBVJMPIYXGAKMD-BYUXKFDVSA-N |
| XLogP | 4.20 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|