C26H52N4O3 — CID 54345253
1,5-bis(2,6-diethylmorpholin-4-yl)-3-(morpholin-4-ylmethyl)pentan-3-amine (PubChem CID 54345253) has the molecular formula C26H52N4O3 and a molecular weight of 468.73 g/mol. Its IUPAC name is 1,5-bis(2,6-diethylmorpholin-4-yl)-3-(morpholin-4-ylmethyl)pentan-3-amine.
| Compound Name | 1,5-bis(2,6-diethylmorpholin-4-yl)-3-(morpholin-4-ylmethyl)pentan-3-amine |
|---|---|
| PubChem CID | 54345253 |
| Molecular Formula | C26H52N4O3 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | 1,5-bis(2,6-diethylmorpholin-4-yl)-3-(morpholin-4-ylmethyl)pentan-3-amine |
| SMILES | CCC1CN(CCC(N)(CCN2CC(CC)OC(CC)C2)CN2CCOCC2)CC(CC)O1 |
| InChI | InChI=1S/C26H52N4O3/c1-5-22-17-29(18-23(6-2)32-22)11-9-26(27,21-28-13-15-31-16-14-28)10-12-30-19-24(7-3)33-25(8-4)20-30/h22-25H,5-21,27H2,1-4H3 |
| InChIKey | UBWLYQCBZVFKDW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |