C26H44N2O2 — CID 54345373
3,7,11,15-tetramethyl-N-(2-morpholin-4-ylethyl)hexadeca-2,6,10,14-tetraenamide (PubChem CID 54345373) has the molecular formula C26H44N2O2 and a molecular weight of 416.65 g/mol. Its IUPAC name is 3,7,11,15-tetramethyl-N-(2-morpholin-4-ylethyl)hexadeca-2,6,10,14-tetraenamide.
| Compound Name | 3,7,11,15-tetramethyl-N-(2-morpholin-4-ylethyl)hexadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 54345373 |
| Molecular Formula | C26H44N2O2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | 3,7,11,15-tetramethyl-N-(2-morpholin-4-ylethyl)hexadeca-2,6,10,14-tetraenamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C26H44N2O2/c1-22(2)9-6-10-23(3)11-7-12-24(4)13-8-14-25(5)21-26(29)27-15-16-28-17-19-30-20-18-28/h9,11,13,21H,6-8,10,12,14-20H2,1-5H3,(H,27,29) |
| InChIKey | UBYLKSJQHXKICG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|