C8H4F2N2S2 — CID 54345912
3-(2,5-difluorophenyl)-2H-1,2,4-thiadiazole-5-thione (PubChem CID 54345912) has the molecular formula C8H4F2N2S2 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-2H-1,2,4-thiadiazole-5-thione.
| Compound Name | 3-(2,5-difluorophenyl)-2H-1,2,4-thiadiazole-5-thione |
|---|---|
| PubChem CID | 54345912 |
| Molecular Formula | C8H4F2N2S2 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 3-(2,5-difluorophenyl)-2H-1,2,4-thiadiazole-5-thione |
| SMILES | Fc1ccc(F)c(-c2nc(=S)s[nH]2)c1 |
| InChI | InChI=1S/C8H4F2N2S2/c9-4-1-2-6(10)5(3-4)7-11-8(13)14-12-7/h1-3H,(H,11,12,13) |
| InChIKey | UCHOVGOEZFBXQM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|