About 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine
3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 54346079) has the molecular formula C17H17Cl2N5
and a molecular weight of 362.26 g/mol. Its IUPAC name is 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 54346079 |
| Molecular Formula | C17H17Cl2N5 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1cnc(N2CCN(Cc3c[nH]c4ncccc34)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N5/c18-13-8-15(19)17(22-10-13)24-6-4-23(5-7-24)11-12-9-21-16-14(12)2-1-3-20-16/h1-3,8-10H,4-7,11H2,(H,20,21) |
| InChIKey | UCJZNDRHOUBTQQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine (CID 54346079) is 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine is Clc1cnc(N2CCN(Cc3c[nH]c4ncccc34)CC2)c(Cl)c1.
What is the InChIKey of 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is UCJZNDRHOUBTQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl2N5/c18-13-8-15(19)17(22-10-13)24-6-4-23(5-7-24)11-12-9-21-16-14(12)2-1-3-20-16/h1-3,8-10H,4-7,11H2,(H,20,21).
What are the key properties of 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine?
3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 362.26 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]methyl]-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 54346079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).