C15H18O3 — CID 54346802
9-oxo-2,3,4,4a,4b,5,6,7-octahydro-1H-phenanthrene-1-carboxylic acid (PubChem CID 54346802) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 9-oxo-2,3,4,4a,4b,5,6,7-octahydro-1H-phenanthrene-1-carboxylic acid.
| Compound Name | 9-oxo-2,3,4,4a,4b,5,6,7-octahydro-1H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 54346802 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 9-oxo-2,3,4,4a,4b,5,6,7-octahydro-1H-phenanthrene-1-carboxylic acid |
| SMILES | O=C1C=C2C(C(=O)O)CCCC2C2CCCC=C12 |
| InChI | InChI=1S/C15H18O3/c16-14-8-13-10(6-3-7-12(13)15(17)18)9-4-1-2-5-11(9)14/h5,8-10,12H,1-4,6-7H2,(H,17,18) |
| InChIKey | UCVVRZUDKNTLNZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |