C6H11N3 — CID 54346863
1,4,6-trimethyl-2H-1,3,5-triazine (PubChem CID 54346863) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 1,4,6-trimethyl-2H-1,3,5-triazine.
| Compound Name | 1,4,6-trimethyl-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 54346863 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 1,4,6-trimethyl-2H-1,3,5-triazine |
| SMILES | CC1=NCN(C)C(C)=N1 |
| InChI | InChI=1S/C6H11N3/c1-5-7-4-9(3)6(2)8-5/h4H2,1-3H3 |
| InChIKey | UCXDRYBPQRODDY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |