C40H56O4Si4 — CID 54347046
2,4,6,8-tetramethyl-2,4,6,8-tetrakis(2-phenylpropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 54347046) has the molecular formula C40H56O4Si4 and a molecular weight of 713.23 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,4,6,8-tetrakis(2-phenylpropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2,4,6,8-tetrakis(2-phenylpropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 54347046 |
| Molecular Formula | C40H56O4Si4 |
| Molecular Weight | 713.23 g/mol |
| Exact Mass | 712.33 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,4,6,8-tetrakis(2-phenylpropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CC(C[Si]1(C)O[Si](C)(CC(C)c2ccccc2)O[Si](C)(CC(C)c2ccccc2)O[Si](C)(CC(C)c2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C40H56O4Si4/c1-33(37-21-13-9-14-22-37)29-45(5)41-46(6,30-34(2)38-23-15-10-16-24-38)43-48(8,32-36(4)40-27-19-12-20-28-40)44-47(7,42-45)31-35(3)39-25-17-11-18-26-39/h9-28,33-36H,29-32H2,1-8H3 |
| InChIKey | UDALYDPBXVOKDC-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.23 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|