C15H27N3O — CID 54348819
1-(2-azaspiro[5.5]undecan-1-yl)-1,3-diazepan-2-one (PubChem CID 54348819) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-(2-azaspiro[5.5]undecan-1-yl)-1,3-diazepan-2-one.
| Compound Name | 1-(2-azaspiro[5.5]undecan-1-yl)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 54348819 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 1-(2-azaspiro[5.5]undecan-1-yl)-1,3-diazepan-2-one |
| SMILES | O=C1NCCCCN1C1NCCCC12CCCCC2 |
| InChI | InChI=1S/C15H27N3O/c19-14-17-10-4-5-12-18(14)13-15(9-6-11-16-13)7-2-1-3-8-15/h13,16H,1-12H2,(H,17,19) |
| InChIKey | UEFOOLAJWCGJAC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |