C15H24O2 — CID 543489
6,10-dimethyl-3-methylidene-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[b]furan-2-one (PubChem CID 543489) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 6,10-dimethyl-3-methylidene-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[b]furan-2-one.
| Compound Name | 6,10-dimethyl-3-methylidene-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 543489 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 6,10-dimethyl-3-methylidene-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[b]furan-2-one |
| SMILES | C=C1C(=O)OC2CC(C)CCCC(C)CCC12 |
| InChI | InChI=1S/C15H24O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h10-11,13-14H,3-9H2,1-2H3 |
| InChIKey | WWUGBOBPGQNKDB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|