C12H8F3NO3 — CID 54348973
N-(5-oxo-2H-furan-3-yl)-4-(trifluoromethyl)benzamide (PubChem CID 54348973) has the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. Its IUPAC name is N-(5-oxo-2H-furan-3-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(5-oxo-2H-furan-3-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 54348973 |
| Molecular Formula | C12H8F3NO3 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | N-(5-oxo-2H-furan-3-yl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C1C=C(NC(=O)c2ccc(C(F)(F)F)cc2)CO1 |
| InChI | InChI=1S/C12H8F3NO3/c13-12(14,15)8-3-1-7(2-4-8)11(18)16-9-5-10(17)19-6-9/h1-5H,6H2,(H,16,18) |
| InChIKey | UEINQUGQANTNJH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |