About 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid
2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid (PubChem CID 54348985) has the molecular formula C13H11IN2O5
and a molecular weight of 402.14 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid |
| PubChem CID | 54348985 |
| Molecular Formula | C13H11IN2O5 |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid |
| SMILES | O=C(CI)Nc1ccc(C(=O)O)c(-n2c(O)ccc2O)c1 |
| InChI | InChI=1S/C13H11IN2O5/c14-6-10(17)15-7-1-2-8(13(20)21)9(5-7)16-11(18)3-4-12(16)19/h1-5,18-19H,6H2,(H,15,17)(H,20,21) |
| InChIKey | UEIUGBYNBHETEP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid?
The IUPAC name of 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid (CID 54348985) is 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid.
What is the SMILES notation for 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid?
The canonical SMILES for 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid is O=C(CI)Nc1ccc(C(=O)O)c(-n2c(O)ccc2O)c1.
What is the InChIKey of 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid?
The InChIKey is UEIUGBYNBHETEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11IN2O5/c14-6-10(17)15-7-1-2-8(13(20)21)9(5-7)16-11(18)3-4-12(16)19/h1-5,18-19H,6H2,(H,15,17)(H,20,21).
What are the key properties of 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid?
2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid has a molecular weight of 402.14 g/mol, XLogP of 1.96, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydroxypyrrol-1-yl)-4-[(2-iodoacetyl)amino]benzoic acid is sourced from PubChem (CID 54348985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).