About 5-hydroxypentanimidamide
5-hydroxypentanimidamide (PubChem CID 54349250) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 5-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 5-hydroxypentanimidamide |
| PubChem CID | 54349250 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 5-hydroxypentanimidamide |
| SMILES | [H]/N=C(/N)CCCCO |
| InChI | InChI=1S/C5H12N2O/c6-5(7)3-1-2-4-8/h8H,1-4H2,(H3,6,7) |
| InChIKey | LWYKJYLCTATPBU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxypentanimidamide?
The IUPAC name of 5-hydroxypentanimidamide (CID 54349250) is 5-hydroxypentanimidamide.
What is the SMILES notation for 5-hydroxypentanimidamide?
The canonical SMILES for 5-hydroxypentanimidamide is [H]/N=C(/N)CCCCO.
What is the InChIKey of 5-hydroxypentanimidamide?
The InChIKey is LWYKJYLCTATPBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c6-5(7)3-1-2-4-8/h8H,1-4H2,(H3,6,7).
What are the key properties of 5-hydroxypentanimidamide?
5-hydroxypentanimidamide has a molecular weight of 116.16 g/mol, XLogP of 0.08, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxypentanimidamide is sourced from PubChem (CID 54349250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).