About (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid
(2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid (PubChem CID 54349651) has the molecular formula C8H13FO4
and a molecular weight of 192.19 g/mol. Its IUPAC name is (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid.
Molecular Properties
| Compound Name | (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid |
| PubChem CID | 54349651 |
| Molecular Formula | C8H13FO4 |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid |
| SMILES | CC1(C)OC[C@H](C[C@H](F)C(=O)O)O1 |
| InChI | InChI=1S/C8H13FO4/c1-8(2)12-4-5(13-8)3-6(9)7(10)11/h5-6H,3-4H2,1-2H3,(H,10,11)/t5-,6-/m0/s1 |
| InChIKey | UEVCBBXKWGVGRR-WDSKDSINSA-N |
| XLogP | 0.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid?
The IUPAC name of (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid (CID 54349651) is (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid.
What is the SMILES notation for (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid?
The canonical SMILES for (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid is CC1(C)OC[C@H](C[C@H](F)C(=O)O)O1.
What is the InChIKey of (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid?
The InChIKey is UEVCBBXKWGVGRR-WDSKDSINSA-N. The full InChI is InChI=1S/C8H13FO4/c1-8(2)12-4-5(13-8)3-6(9)7(10)11/h5-6H,3-4H2,1-2H3,(H,10,11)/t5-,6-/m0/s1.
What are the key properties of (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid?
(2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid has a molecular weight of 192.19 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoropropanoic acid is sourced from PubChem (CID 54349651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).