C37H40O7 — CID 54349839
1-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropan-2-one (PubChem CID 54349839) has the molecular formula C37H40O7 and a molecular weight of 596.72 g/mol. Its IUPAC name is 1-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropan-2-one.
| Compound Name | 1-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropan-2-one |
|---|---|
| PubChem CID | 54349839 |
| Molecular Formula | C37H40O7 |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | 1-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropan-2-one |
| SMILES | CC(=O)COC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C37H40O7/c1-28(38)22-43-37-36(42-26-32-20-12-5-13-21-32)35(41-25-31-18-10-4-11-19-31)34(40-24-30-16-8-3-9-17-30)33(44-37)27-39-23-29-14-6-2-7-15-29/h2-21,33-37H,22-27H2,1H3 |
| InChIKey | UEYJWPRLMIGVMY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |