C26H38O7 — CID 54349904
[(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] icosa-5,8,11,14-tetraenoate (PubChem CID 54349904) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] icosa-5,8,11,14-tetraenoate.
| Compound Name | [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 54349904 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC[C@H](O)[C@H]1OC(=O)C(O)C1=O |
| InChI | InChI=1S/C26H38O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(28)32-20-21(27)25-23(29)24(30)26(31)33-25/h6-7,9-10,12-13,15-16,21,24-25,27,30H,2-5,8,11,14,17-20H2,1H3/t21-,24?,25+/m0/s1 |
| InChIKey | UEZLXAONJGUCGO-DYJPPOHHSA-N |
| XLogP | 3.89 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|