About N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide
N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide (PubChem CID 5435009) has the molecular formula C22H28N4O3
and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide.
Molecular Properties
| Compound Name | N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide |
| PubChem CID | 5435009 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide |
| SMILES | COc1ccc(/C=N\NC(=O)CCN2CCN(c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C22H28N4O3/c1-28-20-9-8-18(16-21(20)29-2)17-23-24-22(27)10-11-25-12-14-26(15-13-25)19-6-4-3-5-7-19/h3-9,16-17H,10-15H2,1-2H3,(H,24,27)/b23-17- |
| InChIKey | OEGOSRVVPLVPIC-QJOMJCCJSA-N |
| XLogP | 2.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide?
The IUPAC name of N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide (CID 5435009) is N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide.
What is the SMILES notation for N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide?
The canonical SMILES for N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide is COc1ccc(/C=N\NC(=O)CCN2CCN(c3ccccc3)CC2)cc1OC.
What is the InChIKey of N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide?
The InChIKey is OEGOSRVVPLVPIC-QJOMJCCJSA-N. The full InChI is InChI=1S/C22H28N4O3/c1-28-20-9-8-18(16-21(20)29-2)17-23-24-22(27)10-11-25-12-14-26(15-13-25)19-6-4-3-5-7-19/h3-9,16-17H,10-15H2,1-2H3,(H,24,27)/b23-17-.
What are the key properties of N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide?
N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide has a molecular weight of 396.49 g/mol, XLogP of 2.37, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide is sourced from PubChem (CID 5435009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).