About 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione
2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 54350123) has the molecular formula C20H24ClNO6S
and a molecular weight of 441.93 g/mol. Its IUPAC name is 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione |
| PubChem CID | 54350123 |
| Molecular Formula | C20H24ClNO6S |
| Molecular Weight | 441.93 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C(=O)c2ccc(S(C)(=O)=O)c(N3CCOCC3)c2Cl)C(=O)C1 |
| InChI | InChI=1S/C20H24ClNO6S/c1-20(2)10-13(23)16(14(24)11-20)19(25)12-4-5-15(29(3,26)27)18(17(12)21)22-6-8-28-9-7-22/h4-5,16H,6-11H2,1-3H3 |
| InChIKey | UFDCANBVXITGPS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.93 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione?
The IUPAC name of 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione (CID 54350123) is 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione.
What is the SMILES notation for 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione?
The canonical SMILES for 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione is CC1(C)CC(=O)C(C(=O)c2ccc(S(C)(=O)=O)c(N3CCOCC3)c2Cl)C(=O)C1.
What is the InChIKey of 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione?
The InChIKey is UFDCANBVXITGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24ClNO6S/c1-20(2)10-13(23)16(14(24)11-20)19(25)12-4-5-15(29(3,26)27)18(17(12)21)22-6-8-28-9-7-22/h4-5,16H,6-11H2,1-3H3.
What are the key properties of 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione?
2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione has a molecular weight of 441.93 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-4-methylsulfonyl-3-morpholin-4-ylbenzoyl)-5,5-dimethylcyclohexane-1,3-dione is sourced from PubChem (CID 54350123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).