About 6-tridecoxyhexane-2,3-diamine
6-tridecoxyhexane-2,3-diamine (PubChem CID 54350380) has the molecular formula C19H42N2O
and a molecular weight of 314.56 g/mol. Its IUPAC name is 6-tridecoxyhexane-2,3-diamine.
Molecular Properties
| Compound Name | 6-tridecoxyhexane-2,3-diamine |
| PubChem CID | 54350380 |
| Molecular Formula | C19H42N2O |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.33 |
| IUPAC Name | 6-tridecoxyhexane-2,3-diamine |
| SMILES | CCCCCCCCCCCCCOCCCC(N)C(C)N |
| InChI | InChI=1S/C19H42N2O/c1-3-4-5-6-7-8-9-10-11-12-13-16-22-17-14-15-19(21)18(2)20/h18-19H,3-17,20-21H2,1-2H3 |
| InChIKey | UFHMABIVFXDBSJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-tridecoxyhexane-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tridecoxyhexane-2,3-diamine?
The IUPAC name of 6-tridecoxyhexane-2,3-diamine (CID 54350380) is 6-tridecoxyhexane-2,3-diamine.
What is the SMILES notation for 6-tridecoxyhexane-2,3-diamine?
The canonical SMILES for 6-tridecoxyhexane-2,3-diamine is CCCCCCCCCCCCCOCCCC(N)C(C)N.
What is the InChIKey of 6-tridecoxyhexane-2,3-diamine?
The InChIKey is UFHMABIVFXDBSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H42N2O/c1-3-4-5-6-7-8-9-10-11-12-13-16-22-17-14-15-19(21)18(2)20/h18-19H,3-17,20-21H2,1-2H3.
What are the key properties of 6-tridecoxyhexane-2,3-diamine?
6-tridecoxyhexane-2,3-diamine has a molecular weight of 314.56 g/mol, XLogP of 4.77, 17 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tridecoxyhexane-2,3-diamine is sourced from PubChem (CID 54350380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).