C22H29NO4S — CID 54350504
4-[(2R,3R)-3-ethyl-8-methoxy-1,1-dioxo-5-phenyl-2,3,4,5-tetrahydro-1λ6,4-benzothiazepin-2-yl]butan-2-ol (PubChem CID 54350504) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is 4-[(2R,3R)-3-ethyl-8-methoxy-1,1-dioxo-5-phenyl-2,3,4,5-tetrahydro-1λ6,4-benzothiazepin-2-yl]butan-2-ol.
| Compound Name | 4-[(2R,3R)-3-ethyl-8-methoxy-1,1-dioxo-5-phenyl-2,3,4,5-tetrahydro-1λ6,4-benzothiazepin-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 54350504 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 4-[(2R,3R)-3-ethyl-8-methoxy-1,1-dioxo-5-phenyl-2,3,4,5-tetrahydro-1λ6,4-benzothiazepin-2-yl]butan-2-ol |
| SMILES | CC[C@H]1NC(c2ccccc2)c2ccc(OC)cc2S(=O)(=O)[C@@H]1CCC(C)O |
| InChI | InChI=1S/C22H29NO4S/c1-4-19-20(13-10-15(2)24)28(25,26)21-14-17(27-3)11-12-18(21)22(23-19)16-8-6-5-7-9-16/h5-9,11-12,14-15,19-20,22-24H,4,10,13H2,1-3H3/t15?,19-,20-,22?/m1/s1 |
| InChIKey | UFJQMWLVJDQGLW-GBWCEYSQSA-N |
| XLogP | 3.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |