5-aminocyclohexa-1,5-diene-1-carboxylic acid

C7H9NO2 — CID 54350782

IUPAC5-aminocyclohexa-1,5-diene-1-carboxylic acid
SMILESNC1=CC(C(=O)O)=CCC1
InChIInChI=1S/C7H9NO2/c8-6-3-1-2-5(4-6)7(9)10/h2,4H,1,3,8H2,(H,9,10)
InChIKeyUFOZTRWCCRTNMH-UHFFFAOYSA-N
MW139.15 g/mol
LogP0.63
Rot. Bonds1

About 5-aminocyclohexa-1,5-diene-1-carboxylic acid

5-aminocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 54350782) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 5-aminocyclohexa-1,5-diene-1-carboxylic acid.

Molecular Properties

Compound Name5-aminocyclohexa-1,5-diene-1-carboxylic acid
PubChem CID54350782
Molecular FormulaC7H9NO2
Molecular Weight139.15 g/mol
Exact Mass139.06
IUPAC Name5-aminocyclohexa-1,5-diene-1-carboxylic acid
SMILESNC1=CC(C(=O)O)=CCC1
InChIInChI=1S/C7H9NO2/c8-6-3-1-2-5(4-6)7(9)10/h2,4H,1,3,8H2,(H,9,10)
InChIKeyUFOZTRWCCRTNMH-UHFFFAOYSA-N
XLogP0.63
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500139.15
LogP ≤ 50.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-aminocyclohexa-1,5-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-aminocyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 5-aminocyclohexa-1,5-diene-1-carboxylic acid (CID 54350782) is 5-aminocyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 5-aminocyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 5-aminocyclohexa-1,5-diene-1-carboxylic acid is NC1=CC(C(=O)O)=CCC1.
What is the InChIKey of 5-aminocyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is UFOZTRWCCRTNMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c8-6-3-1-2-5(4-6)7(9)10/h2,4H,1,3,8H2,(H,9,10).
What are the key properties of 5-aminocyclohexa-1,5-diene-1-carboxylic acid?
5-aminocyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 139.15 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminocyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 54350782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).