C20H33NO2 — CID 54350865
7-(hydroxymethyl)-3,11-dimethyl-1-piperidin-1-yldodeca-2,6,10-trien-1-one (PubChem CID 54350865) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 7-(hydroxymethyl)-3,11-dimethyl-1-piperidin-1-yldodeca-2,6,10-trien-1-one.
| Compound Name | 7-(hydroxymethyl)-3,11-dimethyl-1-piperidin-1-yldodeca-2,6,10-trien-1-one |
|---|---|
| PubChem CID | 54350865 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 7-(hydroxymethyl)-3,11-dimethyl-1-piperidin-1-yldodeca-2,6,10-trien-1-one |
| SMILES | CC(C)=CCCC(=CCCC(C)=CC(=O)N1CCCCC1)CO |
| InChI | InChI=1S/C20H33NO2/c1-17(2)9-7-11-19(16-22)12-8-10-18(3)15-20(23)21-13-5-4-6-14-21/h9,12,15,22H,4-8,10-11,13-14,16H2,1-3H3 |
| InChIKey | UFQJKMQIBUWAJF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|