C12H20O5 — CID 54351001
8-hydroxy-4,7-dimethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 54351001) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 8-hydroxy-4,7-dimethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | 8-hydroxy-4,7-dimethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 54351001 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 8-hydroxy-4,7-dimethoxy-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | COC1C=CC(OC)C(O)CC(=O)OC(C)C1 |
| InChI | InChI=1S/C12H20O5/c1-8-6-9(15-2)4-5-11(16-3)10(13)7-12(14)17-8/h4-5,8-11,13H,6-7H2,1-3H3 |
| InChIKey | UFTJZVCPLRSSKL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|