C13H2Cl4F18O2 — CID 54351320
1,5-dichloro-2-[(2,4-dichloro-1,2,3,3,4,5,5,6,6-nonafluorocyclohexyl)oxymethoxy]-1,2,3,3,4,4,5,6,6-nonafluorocyclohexane (PubChem CID 54351320) has the molecular formula C13H2Cl4F18O2 and a molecular weight of 673.93 g/mol. Its IUPAC name is 1,5-dichloro-2-[(2,4-dichloro-1,2,3,3,4,5,5,6,6-nonafluorocyclohexyl)oxymethoxy]-1,2,3,3,4,4,5,6,6-nonafluorocyclohexane.
| Compound Name | 1,5-dichloro-2-[(2,4-dichloro-1,2,3,3,4,5,5,6,6-nonafluorocyclohexyl)oxymethoxy]-1,2,3,3,4,4,5,6,6-nonafluorocyclohexane |
|---|---|
| PubChem CID | 54351320 |
| Molecular Formula | C13H2Cl4F18O2 |
| Molecular Weight | 673.93 g/mol |
| Exact Mass | 671.85 |
| IUPAC Name | 1,5-dichloro-2-[(2,4-dichloro-1,2,3,3,4,5,5,6,6-nonafluorocyclohexyl)oxymethoxy]-1,2,3,3,4,4,5,6,6-nonafluorocyclohexane |
| SMILES | FC1(F)C(F)(F)C(F)(OCOC2(F)C(F)(F)C(F)(F)C(F)(Cl)C(F)(F)C2(F)Cl)C(F)(Cl)C(F)(F)C1(F)Cl |
| InChI | InChI=1S/C13H2Cl4F18O2/c14-2(18)6(22,23)4(16,20)12(34,10(30,31)8(2,26)27)36-1-37-13(35)5(17,21)7(24,25)3(15,19)9(28,29)11(13,32)33/h1H2 |
| InChIKey | UFZILWGDOPYPCM-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.93 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|