C8H6Cl4 — CID 54351521
1,2,3,4-tetrachloro-5-prop-2-enylcyclopenta-1,3-diene (PubChem CID 54351521) has the molecular formula C8H6Cl4 and a molecular weight of 243.95 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-5-prop-2-enylcyclopenta-1,3-diene.
| Compound Name | 1,2,3,4-tetrachloro-5-prop-2-enylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 54351521 |
| Molecular Formula | C8H6Cl4 |
| Molecular Weight | 243.95 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | 1,2,3,4-tetrachloro-5-prop-2-enylcyclopenta-1,3-diene |
| SMILES | C=CCC1C(Cl)=C(Cl)C(Cl)=C1Cl |
| InChI | InChI=1S/C8H6Cl4/c1-2-3-4-5(9)7(11)8(12)6(4)10/h2,4H,1,3H2 |
| InChIKey | UGCOSNSUAMNNTP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|