C25H26N8O — CID 54351919
2-[6-tert-butyl-7-[4-(dimethylamino)phenyl]iminopyrazolo[5,1-c][1,2,4]triazol-3-yl]-4-methylphthalazin-1-one (PubChem CID 54351919) has the molecular formula C25H26N8O and a molecular weight of 454.54 g/mol. Its IUPAC name is 2-[6-tert-butyl-7-[4-(dimethylamino)phenyl]iminopyrazolo[5,1-c][1,2,4]triazol-3-yl]-4-methylphthalazin-1-one.
| Compound Name | 2-[6-tert-butyl-7-[4-(dimethylamino)phenyl]iminopyrazolo[5,1-c][1,2,4]triazol-3-yl]-4-methylphthalazin-1-one |
|---|---|
| PubChem CID | 54351919 |
| Molecular Formula | C25H26N8O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2-[6-tert-butyl-7-[4-(dimethylamino)phenyl]iminopyrazolo[5,1-c][1,2,4]triazol-3-yl]-4-methylphthalazin-1-one |
| SMILES | Cc1nn(-c2nnc3n2N=C(C(C)(C)C)/C3=N/c2ccc(N(C)C)cc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H26N8O/c1-15-18-9-7-8-10-19(18)23(34)33(29-15)24-28-27-22-20(21(25(2,3)4)30-32(22)24)26-16-11-13-17(14-12-16)31(5)6/h7-14H,1-6H3/b26-20- |
| InChIKey | UGJGYTFNDUVPHB-QOMWVZHYSA-N |
| XLogP | 3.74 |
| TPSA | 93.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|