C15H17BrO6 — CID 54352936
dimethyl (2R,6R)-1-bromo-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8,9-dicarboxylate (PubChem CID 54352936) has the molecular formula C15H17BrO6 and a molecular weight of 373.20 g/mol. Its IUPAC name is dimethyl (2R,6R)-1-bromo-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8,9-dicarboxylate.
| Compound Name | dimethyl (2R,6R)-1-bromo-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 54352936 |
| Molecular Formula | C15H17BrO6 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | dimethyl (2R,6R)-1-bromo-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8,9-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(Br)C=CC1[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H17BrO6/c1-14(2)21-10-7-5-6-15(16,11(10)22-14)9(13(18)20-4)8(7)12(17)19-3/h5-7,10-11H,1-4H3/t7?,10-,11-,15?/m1/s1 |
| InChIKey | UHBGWWPDXYMYAA-LASISWSHSA-N |
| XLogP | 1.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|