C19H36N8O6 — CID 54352954
tert-butyl N-[(2R)-5-(carbamoylamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 54352954) has the molecular formula C19H36N8O6 and a molecular weight of 472.55 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-(carbamoylamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-(carbamoylamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 54352954 |
| Molecular Formula | C19H36N8O6 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | tert-butyl N-[(2R)-5-(carbamoylamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCNC(N)=O)C(=O)NCC(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C19H36N8O6/c1-19(2,3)33-18(32)27-13(7-5-9-24-17(22)31)15(30)25-10-14(29)26-12(11-28)6-4-8-23-16(20)21/h11-13H,4-10H2,1-3H3,(H,25,30)(H,26,29)(H,27,32)(H4,20,21,23)(H3,22,24,31)/t12-,13+/m0/s1 |
| InChIKey | UHBLUUDILUMMEA-QWHCGFSZSA-N |
| XLogP | -1.82 |
| TPSA | 233.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|