C18H24O5 — CID 54353318
(2-acetyloxy-2,3,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl) acetate (PubChem CID 54353318) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2-acetyloxy-2,3,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl) acetate.
| Compound Name | (2-acetyloxy-2,3,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl) acetate |
|---|---|
| PubChem CID | 54353318 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2-acetyloxy-2,3,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl) acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CC(C)C(C)(OC(C)=O)O2 |
| InChI | InChI=1S/C18H24O5/c1-9-8-15-12(4)16(21-13(5)19)10(2)11(3)17(15)23-18(9,7)22-14(6)20/h9H,8H2,1-7H3 |
| InChIKey | UHHZGKTYAPADDU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|